C25H20ClF5N4O2 — CID 91179139
N-[3-chloro-4-[3-(1,1-difluoroprop-2-enyl)phenoxy]phenyl]-5-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 91179139) has the molecular formula C25H20ClF5N4O2 and a molecular weight of 538.90 g/mol. Its IUPAC name is N-[3-chloro-4-[3-(1,1-difluoroprop-2-enyl)phenoxy]phenyl]-5-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[3-chloro-4-[3-(1,1-difluoroprop-2-enyl)phenoxy]phenyl]-5-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91179139 |
| Molecular Formula | C25H20ClF5N4O2 |
| Molecular Weight | 538.90 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | N-[3-chloro-4-[3-(1,1-difluoroprop-2-enyl)phenoxy]phenyl]-5-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | C=CC(F)(F)c1cccc(Oc2ccc(Nc3ncnc4ccn(CCOCC(F)(F)F)c34)cc2Cl)c1 |
| InChI | InChI=1S/C25H20ClF5N4O2/c1-2-24(27,28)16-4-3-5-18(12-16)37-21-7-6-17(13-19(21)26)34-23-22-20(32-15-33-23)8-9-35(22)10-11-36-14-25(29,30)31/h2-9,12-13,15H,1,10-11,14H2,(H,32,33,34) |
| InChIKey | NQGMLAKHCRKOSM-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.90 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|