C12H19ClN2O4 — CID 142758338
2-amino-N-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide;hydrate (PubChem CID 142758338) has the molecular formula C12H19ClN2O4 and a molecular weight of 290.75 g/mol. Its IUPAC name is 2-amino-N-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide;hydrate.
| Compound Name | 2-amino-N-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide;hydrate |
|---|---|
| PubChem CID | 142758338 |
| Molecular Formula | C12H19ClN2O4 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-amino-N-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide;hydrate |
| SMILES | COc1ccc(CCN(Cl)C(=O)CN)cc1OC.O |
| InChI | InChI=1S/C12H17ClN2O3.H2O/c1-17-10-4-3-9(7-11(10)18-2)5-6-15(13)12(16)8-14;/h3-4,7H,5-6,8,14H2,1-2H3;1H2 |
| InChIKey | JVGVIYFWXZXLOH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|