C23H28N2O — CID 142759527
1,2,3,6-tetramethyl-5-(2-phenoxyethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 142759527) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is 1,2,3,6-tetramethyl-5-(2-phenoxyethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 1,2,3,6-tetramethyl-5-(2-phenoxyethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 142759527 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1,2,3,6-tetramethyl-5-(2-phenoxyethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1cccc2c3c(n(CCOc4ccccc4)c12)CC(C)N(C)C3C |
| InChI | InChI=1S/C23H28N2O/c1-16-9-8-12-20-22-18(3)24(4)17(2)15-21(22)25(23(16)20)13-14-26-19-10-6-5-7-11-19/h5-12,17-18H,13-15H2,1-4H3 |
| InChIKey | FUBHXRNNULCHHE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|