C12H16ClNO2 — CID 142760496
2-[[3-(aminomethyl)phenyl]methylidene]butanoic acid;hydrochloride (PubChem CID 142760496) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-[[3-(aminomethyl)phenyl]methylidene]butanoic acid;hydrochloride.
| Compound Name | 2-[[3-(aminomethyl)phenyl]methylidene]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 142760496 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[[3-(aminomethyl)phenyl]methylidene]butanoic acid;hydrochloride |
| SMILES | CCC(=Cc1cccc(CN)c1)C(=O)O.Cl |
| InChI | InChI=1S/C12H15NO2.ClH/c1-2-11(12(14)15)7-9-4-3-5-10(6-9)8-13;/h3-7H,2,8,13H2,1H3,(H,14,15);1H |
| InChIKey | ATHNGQPMJOFSPS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|