C11H12FNO2 — CID 141433671
(2E)-2-[(4-amino-3-fluorophenyl)methylidene]butanoic acid (PubChem CID 141433671) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is (2E)-2-[(4-amino-3-fluorophenyl)methylidene]butanoic acid.
| Compound Name | (2E)-2-[(4-amino-3-fluorophenyl)methylidene]butanoic acid |
|---|---|
| PubChem CID | 141433671 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (2E)-2-[(4-amino-3-fluorophenyl)methylidene]butanoic acid |
| SMILES | CC/C(=C\c1ccc(N)c(F)c1)C(=O)O |
| InChI | InChI=1S/C11H12FNO2/c1-2-8(11(14)15)5-7-3-4-10(13)9(12)6-7/h3-6H,2,13H2,1H3,(H,14,15)/b8-5+ |
| InChIKey | IMIRJMMDCWTSCD-VMPITWQZSA-N |
| XLogP | 2.29 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|