C14H16Br2O — CID 122606761
6-[3-(2,2-dibromoethenyl)phenyl]hexan-2-one (PubChem CID 122606761) has the molecular formula C14H16Br2O and a molecular weight of 360.09 g/mol. Its IUPAC name is 6-[3-(2,2-dibromoethenyl)phenyl]hexan-2-one.
| Compound Name | 6-[3-(2,2-dibromoethenyl)phenyl]hexan-2-one |
|---|---|
| PubChem CID | 122606761 |
| Molecular Formula | C14H16Br2O |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 6-[3-(2,2-dibromoethenyl)phenyl]hexan-2-one |
| SMILES | CC(=O)CCCCc1cccc(C=C(Br)Br)c1 |
| InChI | InChI=1S/C14H16Br2O/c1-11(17)5-2-3-6-12-7-4-8-13(9-12)10-14(15)16/h4,7-10H,2-3,5-6H2,1H3 |
| InChIKey | JLBYOISXVZVECT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|