C14H14O4 — CID 142760794
4-(2,4-dihydroxyphenyl)-5-ethylbenzene-1,3-diol (PubChem CID 142760794) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 4-(2,4-dihydroxyphenyl)-5-ethylbenzene-1,3-diol.
| Compound Name | 4-(2,4-dihydroxyphenyl)-5-ethylbenzene-1,3-diol |
|---|---|
| PubChem CID | 142760794 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-(2,4-dihydroxyphenyl)-5-ethylbenzene-1,3-diol |
| SMILES | CCc1cc(O)cc(O)c1-c1ccc(O)cc1O |
| InChI | InChI=1S/C14H14O4/c1-2-8-5-10(16)7-13(18)14(8)11-4-3-9(15)6-12(11)17/h3-7,15-18H,2H2,1H3 |
| InChIKey | AXTGIOSZSDVMFS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |