C13H31NO7Si — CID 142761773
1-[1,2-dihydroxypropyl(triethoxysilylmethyl)amino]propane-1,2-diol (PubChem CID 142761773) has the molecular formula C13H31NO7Si and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-[1,2-dihydroxypropyl(triethoxysilylmethyl)amino]propane-1,2-diol.
| Compound Name | 1-[1,2-dihydroxypropyl(triethoxysilylmethyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 142761773 |
| Molecular Formula | C13H31NO7Si |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[1,2-dihydroxypropyl(triethoxysilylmethyl)amino]propane-1,2-diol |
| SMILES | CCO[Si](CN(C(O)C(C)O)C(O)C(C)O)(OCC)OCC |
| InChI | InChI=1S/C13H31NO7Si/c1-6-19-22(20-7-2,21-8-3)9-14(12(17)10(4)15)13(18)11(5)16/h10-13,15-18H,6-9H2,1-5H3 |
| InChIKey | UJBJIOOWUWVIRX-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|