C29H25ClFN5O4 — CID 142767491
1-[4-chloro-5-[1-ethyl-7-[[(2S)-2-methoxypyran-2-yl]amino]-2-oxo-1,6-naphthyridin-3-yl]-2-fluorophenyl]-3-phenylurea (PubChem CID 142767491) has the molecular formula C29H25ClFN5O4 and a molecular weight of 562.00 g/mol. Its IUPAC name is 1-[4-chloro-5-[1-ethyl-7-[[(2S)-2-methoxypyran-2-yl]amino]-2-oxo-1,6-naphthyridin-3-yl]-2-fluorophenyl]-3-phenylurea.
| Compound Name | 1-[4-chloro-5-[1-ethyl-7-[[(2S)-2-methoxypyran-2-yl]amino]-2-oxo-1,6-naphthyridin-3-yl]-2-fluorophenyl]-3-phenylurea |
|---|---|
| PubChem CID | 142767491 |
| Molecular Formula | C29H25ClFN5O4 |
| Molecular Weight | 562.00 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 1-[4-chloro-5-[1-ethyl-7-[[(2S)-2-methoxypyran-2-yl]amino]-2-oxo-1,6-naphthyridin-3-yl]-2-fluorophenyl]-3-phenylurea |
| SMILES | CCn1c(=O)c(-c2cc(NC(=O)Nc3ccccc3)c(F)cc2Cl)cc2cnc(N[C@]3(OC)C=CC=CO3)cc21 |
| InChI | InChI=1S/C29H25ClFN5O4/c1-3-36-25-16-26(35-29(39-2)11-7-8-12-40-29)32-17-18(25)13-21(27(36)37)20-14-24(23(31)15-22(20)30)34-28(38)33-19-9-5-4-6-10-19/h4-17H,3H2,1-2H3,(H,32,35)(H2,33,34,38)/t29-/m0/s1 |
| InChIKey | GRNUXYUCNVLFFE-LJAQVGFWSA-N |
| XLogP | 6.33 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.00 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|