C26H25ClFN5O2S — CID 86713652
1-[4-chloro-5-[1-ethyl-7-(2-methylsulfanylethylamino)-2-oxo-1,6-naphthyridin-3-yl]-2-fluorophenyl]-3-phenylurea (PubChem CID 86713652) has the molecular formula C26H25ClFN5O2S and a molecular weight of 526.04 g/mol. Its IUPAC name is 1-[4-chloro-5-[1-ethyl-7-(2-methylsulfanylethylamino)-2-oxo-1,6-naphthyridin-3-yl]-2-fluorophenyl]-3-phenylurea.
| Compound Name | 1-[4-chloro-5-[1-ethyl-7-(2-methylsulfanylethylamino)-2-oxo-1,6-naphthyridin-3-yl]-2-fluorophenyl]-3-phenylurea |
|---|---|
| PubChem CID | 86713652 |
| Molecular Formula | C26H25ClFN5O2S |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 1-[4-chloro-5-[1-ethyl-7-(2-methylsulfanylethylamino)-2-oxo-1,6-naphthyridin-3-yl]-2-fluorophenyl]-3-phenylurea |
| SMILES | CCn1c(=O)c(-c2cc(NC(=O)Nc3ccccc3)c(F)cc2Cl)cc2cnc(NCCSC)cc21 |
| InChI | InChI=1S/C26H25ClFN5O2S/c1-3-33-23-14-24(29-9-10-36-2)30-15-16(23)11-19(25(33)34)18-12-22(21(28)13-20(18)27)32-26(35)31-17-7-5-4-6-8-17/h4-8,11-15H,3,9-10H2,1-2H3,(H,29,30)(H2,31,32,35) |
| InChIKey | ZHRYBIXRPTWELM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|