C17H16ClN3O — CID 141205535
3-(2-chlorophenyl)-1-ethyl-7-(methylamino)-1,6-naphthyridin-2-one (PubChem CID 141205535) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-ethyl-7-(methylamino)-1,6-naphthyridin-2-one.
| Compound Name | 3-(2-chlorophenyl)-1-ethyl-7-(methylamino)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 141205535 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-(2-chlorophenyl)-1-ethyl-7-(methylamino)-1,6-naphthyridin-2-one |
| SMILES | CCn1c(=O)c(-c2ccccc2Cl)cc2cnc(NC)cc21 |
| InChI | InChI=1S/C17H16ClN3O/c1-3-21-15-9-16(19-2)20-10-11(15)8-13(17(21)22)12-6-4-5-7-14(12)18/h4-10H,3H2,1-2H3,(H,19,20) |
| InChIKey | RLUVNPVOLHSNLM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |