C26H20Cl2N4O2 — CID 10097133
7,8-bis(2-chlorophenyl)-1,4-diethylpyrazino[2,3-g]quinoxaline-2,3-dione (PubChem CID 10097133) has the molecular formula C26H20Cl2N4O2 and a molecular weight of 491.38 g/mol. Its IUPAC name is 7,8-bis(2-chlorophenyl)-1,4-diethylpyrazino[2,3-g]quinoxaline-2,3-dione.
| Compound Name | 7,8-bis(2-chlorophenyl)-1,4-diethylpyrazino[2,3-g]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10097133 |
| Molecular Formula | C26H20Cl2N4O2 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 7,8-bis(2-chlorophenyl)-1,4-diethylpyrazino[2,3-g]quinoxaline-2,3-dione |
| SMILES | CCn1c(=O)c(=O)n(CC)c2cc3nc(-c4ccccc4Cl)c(-c4ccccc4Cl)nc3cc21 |
| InChI | InChI=1S/C26H20Cl2N4O2/c1-3-31-21-13-19-20(14-22(21)32(4-2)26(34)25(31)33)30-24(16-10-6-8-12-18(16)28)23(29-19)15-9-5-7-11-17(15)27/h5-14H,3-4H2,1-2H3 |
| InChIKey | SVSJNNDMBCWLND-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|