C7H13NO3S2 — CID 142767856
2-(1,5,3-dithiazepan-3-yl)-3-hydroxypropanoic acid (PubChem CID 142767856) has the molecular formula C7H13NO3S2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(1,5,3-dithiazepan-3-yl)-3-hydroxypropanoic acid.
| Compound Name | 2-(1,5,3-dithiazepan-3-yl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 142767856 |
| Molecular Formula | C7H13NO3S2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-(1,5,3-dithiazepan-3-yl)-3-hydroxypropanoic acid |
| SMILES | O=C(O)C(CO)N1CSCCSC1 |
| InChI | InChI=1S/C7H13NO3S2/c9-3-6(7(10)11)8-4-12-1-2-13-5-8/h6,9H,1-5H2,(H,10,11) |
| InChIKey | HFXXYKNMONSTSN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |