C25H32O3S — CID 142769953
[4-methyl-5-oxo-5-(4-propyl-2-sulfanylphenyl)pentan-2-yl] 4-propylbenzoate (PubChem CID 142769953) has the molecular formula C25H32O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is [4-methyl-5-oxo-5-(4-propyl-2-sulfanylphenyl)pentan-2-yl] 4-propylbenzoate.
| Compound Name | [4-methyl-5-oxo-5-(4-propyl-2-sulfanylphenyl)pentan-2-yl] 4-propylbenzoate |
|---|---|
| PubChem CID | 142769953 |
| Molecular Formula | C25H32O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [4-methyl-5-oxo-5-(4-propyl-2-sulfanylphenyl)pentan-2-yl] 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)OC(C)CC(C)C(=O)c2ccc(CCC)cc2S)cc1 |
| InChI | InChI=1S/C25H32O3S/c1-5-7-19-9-12-21(13-10-19)25(27)28-18(4)15-17(3)24(26)22-14-11-20(8-6-2)16-23(22)29/h9-14,16-18,29H,5-8,15H2,1-4H3 |
| InChIKey | LCHYENTYHJNDAP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|