C31H35FO4 — CID 154442481
3-[4-[(2R)-4-ethylhexan-2-yl]oxycarbonyl-3-fluorophenyl]-4-(4-propylphenyl)benzoic acid (PubChem CID 154442481) has the molecular formula C31H35FO4 and a molecular weight of 490.62 g/mol. Its IUPAC name is 3-[4-[(2R)-4-ethylhexan-2-yl]oxycarbonyl-3-fluorophenyl]-4-(4-propylphenyl)benzoic acid.
| Compound Name | 3-[4-[(2R)-4-ethylhexan-2-yl]oxycarbonyl-3-fluorophenyl]-4-(4-propylphenyl)benzoic acid |
|---|---|
| PubChem CID | 154442481 |
| Molecular Formula | C31H35FO4 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 3-[4-[(2R)-4-ethylhexan-2-yl]oxycarbonyl-3-fluorophenyl]-4-(4-propylphenyl)benzoic acid |
| SMILES | CCCc1ccc(-c2ccc(C(=O)O)cc2-c2ccc(C(=O)O[C@H](C)CC(CC)CC)c(F)c2)cc1 |
| InChI | InChI=1S/C31H35FO4/c1-5-8-22-9-11-23(12-10-22)26-15-14-25(30(33)34)18-28(26)24-13-16-27(29(32)19-24)31(35)36-20(4)17-21(6-2)7-3/h9-16,18-21H,5-8,17H2,1-4H3,(H,33,34)/t20-/m1/s1 |
| InChIKey | HVQADFBYQHEYIY-HXUWFJFHSA-N |
| XLogP | 8.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |