C11H18N2O3 — CID 142770714
[(Z,3S)-2-amino-1-hydroxyhex-1-en-5-yn-3-yl] N-tert-butylcarbamate (PubChem CID 142770714) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is [(Z,3S)-2-amino-1-hydroxyhex-1-en-5-yn-3-yl] N-tert-butylcarbamate.
| Compound Name | [(Z,3S)-2-amino-1-hydroxyhex-1-en-5-yn-3-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 142770714 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [(Z,3S)-2-amino-1-hydroxyhex-1-en-5-yn-3-yl] N-tert-butylcarbamate |
| SMILES | C#CC[C@H](OC(=O)NC(C)(C)C)/C(N)=C/O |
| InChI | InChI=1S/C11H18N2O3/c1-5-6-9(8(12)7-14)16-10(15)13-11(2,3)4/h1,7,9,14H,6,12H2,2-4H3,(H,13,15)/b8-7-/t9-/m0/s1 |
| InChIKey | PZGWUXMHAKREQV-FUOZMLNRSA-N |
| XLogP | 1.26 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|