C12H11N7 — CID 142770808
6-indazol-1-yl-N-prop-2-enyl-1,2,4,5-tetrazin-3-amine (PubChem CID 142770808) has the molecular formula C12H11N7 and a molecular weight of 253.27 g/mol. Its IUPAC name is 6-indazol-1-yl-N-prop-2-enyl-1,2,4,5-tetrazin-3-amine.
| Compound Name | 6-indazol-1-yl-N-prop-2-enyl-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 142770808 |
| Molecular Formula | C12H11N7 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 6-indazol-1-yl-N-prop-2-enyl-1,2,4,5-tetrazin-3-amine |
| SMILES | C=CCNc1nnc(-n2ncc3ccccc32)nn1 |
| InChI | InChI=1S/C12H11N7/c1-2-7-13-11-15-17-12(18-16-11)19-10-6-4-3-5-9(10)8-14-19/h2-6,8H,1,7H2,(H,13,15,16) |
| InChIKey | WTKGWTBRAUZJGT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|