C20H27ClN4O4S2 — CID 142774149
3-[3-(5-chloro-1,3-thiazol-2-yl)oxan-4-yl]-2-[4-[2-(methylamino)ethylsulfamoyl]phenyl]propanamide (PubChem CID 142774149) has the molecular formula C20H27ClN4O4S2 and a molecular weight of 487.05 g/mol. Its IUPAC name is 3-[3-(5-chloro-1,3-thiazol-2-yl)oxan-4-yl]-2-[4-[2-(methylamino)ethylsulfamoyl]phenyl]propanamide.
| Compound Name | 3-[3-(5-chloro-1,3-thiazol-2-yl)oxan-4-yl]-2-[4-[2-(methylamino)ethylsulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 142774149 |
| Molecular Formula | C20H27ClN4O4S2 |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 3-[3-(5-chloro-1,3-thiazol-2-yl)oxan-4-yl]-2-[4-[2-(methylamino)ethylsulfamoyl]phenyl]propanamide |
| SMILES | CNCCNS(=O)(=O)c1ccc(C(CC2CCOCC2c2ncc(Cl)s2)C(N)=O)cc1 |
| InChI | InChI=1S/C20H27ClN4O4S2/c1-23-7-8-25-31(27,28)15-4-2-13(3-5-15)16(19(22)26)10-14-6-9-29-12-17(14)20-24-11-18(21)30-20/h2-5,11,14,16-17,23,25H,6-10,12H2,1H3,(H2,22,26) |
| InChIKey | XFXVMTCNSVPQMM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|