C20H27ClN4O4S2 — CID 21094198
N-(5-chloro-1,3-thiazol-2-yl)-2-[4-[2-(methylamino)ethylsulfamoyl]phenyl]-3-(oxan-4-yl)propanamide (PubChem CID 21094198) has the molecular formula C20H27ClN4O4S2 and a molecular weight of 487.05 g/mol. Its IUPAC name is N-(5-chloro-1,3-thiazol-2-yl)-2-[4-[2-(methylamino)ethylsulfamoyl]phenyl]-3-(oxan-4-yl)propanamide.
| Compound Name | N-(5-chloro-1,3-thiazol-2-yl)-2-[4-[2-(methylamino)ethylsulfamoyl]phenyl]-3-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 21094198 |
| Molecular Formula | C20H27ClN4O4S2 |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-(5-chloro-1,3-thiazol-2-yl)-2-[4-[2-(methylamino)ethylsulfamoyl]phenyl]-3-(oxan-4-yl)propanamide |
| SMILES | CNCCNS(=O)(=O)c1ccc(C(CC2CCOCC2)C(=O)Nc2ncc(Cl)s2)cc1 |
| InChI | InChI=1S/C20H27ClN4O4S2/c1-22-8-9-24-31(27,28)16-4-2-15(3-5-16)17(12-14-6-10-29-11-7-14)19(26)25-20-23-13-18(21)30-20/h2-5,13-14,17,22,24H,6-12H2,1H3,(H,23,25,26) |
| InChIKey | YINFNOHVBJTSBS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|