C21H24O3 — CID 142775367
4-[2-[(2S)-6-methoxy-3,4-dihydro-2H-chromen-2-yl]cyclopentyl]phenol (PubChem CID 142775367) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-[2-[(2S)-6-methoxy-3,4-dihydro-2H-chromen-2-yl]cyclopentyl]phenol.
| Compound Name | 4-[2-[(2S)-6-methoxy-3,4-dihydro-2H-chromen-2-yl]cyclopentyl]phenol |
|---|---|
| PubChem CID | 142775367 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-[2-[(2S)-6-methoxy-3,4-dihydro-2H-chromen-2-yl]cyclopentyl]phenol |
| SMILES | COc1ccc2c(c1)CC[C@@H](C1CCCC1c1ccc(O)cc1)O2 |
| InChI | InChI=1S/C21H24O3/c1-23-17-10-12-20-15(13-17)7-11-21(24-20)19-4-2-3-18(19)14-5-8-16(22)9-6-14/h5-6,8-10,12-13,18-19,21-22H,2-4,7,11H2,1H3/t18?,19?,21-/m0/s1 |
| InChIKey | OFJCCKWHMRELPV-GRERDSQWSA-N |
| XLogP | 4.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |