C16H15FO4 — CID 59790868
4-[(2-fluoro-3,4-dihydro-2H-chromen-6-yl)oxymethoxy]phenol (PubChem CID 59790868) has the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-[(2-fluoro-3,4-dihydro-2H-chromen-6-yl)oxymethoxy]phenol.
| Compound Name | 4-[(2-fluoro-3,4-dihydro-2H-chromen-6-yl)oxymethoxy]phenol |
|---|---|
| PubChem CID | 59790868 |
| Molecular Formula | C16H15FO4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-[(2-fluoro-3,4-dihydro-2H-chromen-6-yl)oxymethoxy]phenol |
| SMILES | Oc1ccc(OCOc2ccc3c(c2)CCC(F)O3)cc1 |
| InChI | InChI=1S/C16H15FO4/c17-16-8-1-11-9-14(6-7-15(11)21-16)20-10-19-13-4-2-12(18)3-5-13/h2-7,9,16,18H,1,8,10H2 |
| InChIKey | HPYARDTWNYXROY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|