C24H23N3O5 — CID 142776497
7-(6,7-dimethoxyquinolin-4-yl)oxy-2-(2-methoxyethyl)quinoline-4-carboxamide (PubChem CID 142776497) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is 7-(6,7-dimethoxyquinolin-4-yl)oxy-2-(2-methoxyethyl)quinoline-4-carboxamide.
| Compound Name | 7-(6,7-dimethoxyquinolin-4-yl)oxy-2-(2-methoxyethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 142776497 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 7-(6,7-dimethoxyquinolin-4-yl)oxy-2-(2-methoxyethyl)quinoline-4-carboxamide |
| SMILES | COCCc1cc(C(N)=O)c2ccc(Oc3ccnc4cc(OC)c(OC)cc34)cc2n1 |
| InChI | InChI=1S/C24H23N3O5/c1-29-9-7-14-10-17(24(25)28)16-5-4-15(11-20(16)27-14)32-21-6-8-26-19-13-23(31-3)22(30-2)12-18(19)21/h4-6,8,10-13H,7,9H2,1-3H3,(H2,25,28) |
| InChIKey | XQWNLLORVXIUIY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |