C17H21F3N2O2 — CID 142776500
2-methylpropyl 4-[3-amino-5-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 142776500) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-methylpropyl 4-[3-amino-5-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[3-amino-5-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 142776500 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-methylpropyl 4-[3-amino-5-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CC=C(c2cc(N)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-11(2)10-24-16(23)22-5-3-12(4-6-22)13-7-14(17(18,19)20)9-15(21)8-13/h3,7-9,11H,4-6,10,21H2,1-2H3 |
| InChIKey | CELIFJFPUBJDEO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|