About (4-pyridin-2-ylphenyl) propaneperoxoate
(4-pyridin-2-ylphenyl) propaneperoxoate (PubChem CID 142777114) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is (4-pyridin-2-ylphenyl) propaneperoxoate.
Molecular Properties
| Compound Name | (4-pyridin-2-ylphenyl) propaneperoxoate |
| PubChem CID | 142777114 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (4-pyridin-2-ylphenyl) propaneperoxoate |
| SMILES | CCC(=O)OOc1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C14H13NO3/c1-2-14(16)18-17-12-8-6-11(7-9-12)13-5-3-4-10-15-13/h3-10H,2H2,1H3 |
| InChIKey | QEOOHZJOMBZUEW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-pyridin-2-ylphenyl) propaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pyridin-2-ylphenyl) propaneperoxoate?
The IUPAC name of (4-pyridin-2-ylphenyl) propaneperoxoate (CID 142777114) is (4-pyridin-2-ylphenyl) propaneperoxoate.
What is the SMILES notation for (4-pyridin-2-ylphenyl) propaneperoxoate?
The canonical SMILES for (4-pyridin-2-ylphenyl) propaneperoxoate is CCC(=O)OOc1ccc(-c2ccccn2)cc1.
What is the InChIKey of (4-pyridin-2-ylphenyl) propaneperoxoate?
The InChIKey is QEOOHZJOMBZUEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3/c1-2-14(16)18-17-12-8-6-11(7-9-12)13-5-3-4-10-15-13/h3-10H,2H2,1H3.
What are the key properties of (4-pyridin-2-ylphenyl) propaneperoxoate?
(4-pyridin-2-ylphenyl) propaneperoxoate has a molecular weight of 243.26 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pyridin-2-ylphenyl) propaneperoxoate is sourced from PubChem (CID 142777114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).