C20H16Cl2N2O4S — CID 142777362
2-chloro-3-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxyethylsulfonyl)benzamide (PubChem CID 142777362) has the molecular formula C20H16Cl2N2O4S and a molecular weight of 451.33 g/mol. Its IUPAC name is 2-chloro-3-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxyethylsulfonyl)benzamide.
| Compound Name | 2-chloro-3-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxyethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 142777362 |
| Molecular Formula | C20H16Cl2N2O4S |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-chloro-3-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxyethylsulfonyl)benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)CCO)c(-c2ccc(Cl)c(-c3ccccn3)c2)c1Cl |
| InChI | InChI=1S/C20H16Cl2N2O4S/c21-15-6-4-12(11-14(15)16-3-1-2-8-24-16)18-17(29(27,28)10-9-25)7-5-13(19(18)22)20(23)26/h1-8,11,25H,9-10H2,(H2,23,26) |
| InChIKey | KPRGHOUVOYPQRK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |