C21H16ClN5O — CID 142786865
3-(4-chloro-3-pyridin-2-ylphenyl)-4-(1,2,4-triazol-1-ylmethyl)benzamide (PubChem CID 142786865) has the molecular formula C21H16ClN5O and a molecular weight of 389.85 g/mol. Its IUPAC name is 3-(4-chloro-3-pyridin-2-ylphenyl)-4-(1,2,4-triazol-1-ylmethyl)benzamide.
| Compound Name | 3-(4-chloro-3-pyridin-2-ylphenyl)-4-(1,2,4-triazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 142786865 |
| Molecular Formula | C21H16ClN5O |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-(4-chloro-3-pyridin-2-ylphenyl)-4-(1,2,4-triazol-1-ylmethyl)benzamide |
| SMILES | NC(=O)c1ccc(Cn2cncn2)c(-c2ccc(Cl)c(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C21H16ClN5O/c22-19-7-6-14(9-18(19)20-3-1-2-8-25-20)17-10-15(21(23)28)4-5-16(17)11-27-13-24-12-26-27/h1-10,12-13H,11H2,(H2,23,28) |
| InChIKey | CMZKCZJDUGJPJW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |