C25H21ClN4O2 — CID 142786931
1-(4-chloro-3-pyridin-2-ylphenyl)-4-(pyridin-2-ylmethyl)cyclohexa-2,5-diene-1,4-dicarboxamide (PubChem CID 142786931) has the molecular formula C25H21ClN4O2 and a molecular weight of 444.92 g/mol. Its IUPAC name is 1-(4-chloro-3-pyridin-2-ylphenyl)-4-(pyridin-2-ylmethyl)cyclohexa-2,5-diene-1,4-dicarboxamide.
| Compound Name | 1-(4-chloro-3-pyridin-2-ylphenyl)-4-(pyridin-2-ylmethyl)cyclohexa-2,5-diene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 142786931 |
| Molecular Formula | C25H21ClN4O2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 1-(4-chloro-3-pyridin-2-ylphenyl)-4-(pyridin-2-ylmethyl)cyclohexa-2,5-diene-1,4-dicarboxamide |
| SMILES | NC(=O)C1(Cc2ccccn2)C=CC(C(N)=O)(c2ccc(Cl)c(-c3ccccn3)c2)C=C1 |
| InChI | InChI=1S/C25H21ClN4O2/c26-20-8-7-17(15-19(20)21-6-2-4-14-30-21)25(23(28)32)11-9-24(10-12-25,22(27)31)16-18-5-1-3-13-29-18/h1-15H,16H2,(H2,27,31)(H2,28,32) |
| InChIKey | SNATZUWFNQYLIY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|