C27H23Cl2N3O3 — CID 142786934
(1R)-2-chloro-1-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxy-1-phenylethyl)cyclohexa-2,5-diene-1,4-dicarboxamide (PubChem CID 142786934) has the molecular formula C27H23Cl2N3O3 and a molecular weight of 508.41 g/mol. Its IUPAC name is (1R)-2-chloro-1-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxy-1-phenylethyl)cyclohexa-2,5-diene-1,4-dicarboxamide.
| Compound Name | (1R)-2-chloro-1-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxy-1-phenylethyl)cyclohexa-2,5-diene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 142786934 |
| Molecular Formula | C27H23Cl2N3O3 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | (1R)-2-chloro-1-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxy-1-phenylethyl)cyclohexa-2,5-diene-1,4-dicarboxamide |
| SMILES | NC(=O)C1(C(CO)c2ccccc2)C=C[C@](C(N)=O)(c2ccc(Cl)c(-c3ccccn3)c2)C(Cl)=C1 |
| InChI | InChI=1S/C27H23Cl2N3O3/c28-21-10-9-18(14-19(21)22-8-4-5-13-32-22)27(25(31)35)12-11-26(24(30)34,15-23(27)29)20(16-33)17-6-2-1-3-7-17/h1-15,20,33H,16H2,(H2,30,34)(H2,31,35)/t20?,26?,27-/m0/s1 |
| InChIKey | CNLMSOFEILEQMU-XINNPMCZSA-N |
| XLogP | 4.07 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|