C19H12BrF3N4O — CID 142779123
2-bromo-5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]oxy-1,2-dihydroquinoxaline (PubChem CID 142779123) has the molecular formula C19H12BrF3N4O and a molecular weight of 449.23 g/mol. Its IUPAC name is 2-bromo-5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]oxy-1,2-dihydroquinoxaline.
| Compound Name | 2-bromo-5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]oxy-1,2-dihydroquinoxaline |
|---|---|
| PubChem CID | 142779123 |
| Molecular Formula | C19H12BrF3N4O |
| Molecular Weight | 449.23 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 2-bromo-5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]oxy-1,2-dihydroquinoxaline |
| SMILES | FC(F)(F)c1ccc(-c2cc(Oc3cccc4c3N=CC(Br)N4)ncn2)cc1 |
| InChI | InChI=1S/C19H12BrF3N4O/c20-16-9-24-18-13(27-16)2-1-3-15(18)28-17-8-14(25-10-26-17)11-4-6-12(7-5-11)19(21,22)23/h1-10,16,27H |
| InChIKey | DCXYJFKCBOGUFO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.23 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|