C14H16O6 — CID 142780215
3-(5-acetyl-4-acetyloxy-5-methoxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid (PubChem CID 142780215) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-(5-acetyl-4-acetyloxy-5-methoxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid.
| Compound Name | 3-(5-acetyl-4-acetyloxy-5-methoxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 142780215 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-(5-acetyl-4-acetyloxy-5-methoxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid |
| SMILES | COC1(C(C)=O)CC(C=CC(=O)O)=CC=C1OC(C)=O |
| InChI | InChI=1S/C14H16O6/c1-9(15)14(19-3)8-11(5-7-13(17)18)4-6-12(14)20-10(2)16/h4-7H,8H2,1-3H3,(H,17,18) |
| InChIKey | JYEBWIWXHMJXIP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|