About (2-bromo-4,5-difluorophenoxy)boronic acid
(2-bromo-4,5-difluorophenoxy)boronic acid (PubChem CID 142781250) has the molecular formula C6H4BBrF2O3
and a molecular weight of 252.81 g/mol. Its IUPAC name is (2-bromo-4,5-difluorophenoxy)boronic acid.
Molecular Properties
| Compound Name | (2-bromo-4,5-difluorophenoxy)boronic acid |
| PubChem CID | 142781250 |
| Molecular Formula | C6H4BBrF2O3 |
| Molecular Weight | 252.81 g/mol |
| Exact Mass | 251.94 |
| IUPAC Name | (2-bromo-4,5-difluorophenoxy)boronic acid |
| SMILES | OB(O)Oc1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C6H4BBrF2O3/c8-3-1-4(9)5(10)2-6(3)13-7(11)12/h1-2,11-12H |
| InChIKey | YNMBTAROLBMPHX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.81 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4,5-difluorophenoxy)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4,5-difluorophenoxy)boronic acid?
The IUPAC name of (2-bromo-4,5-difluorophenoxy)boronic acid (CID 142781250) is (2-bromo-4,5-difluorophenoxy)boronic acid.
What is the SMILES notation for (2-bromo-4,5-difluorophenoxy)boronic acid?
The canonical SMILES for (2-bromo-4,5-difluorophenoxy)boronic acid is OB(O)Oc1cc(F)c(F)cc1Br.
What is the InChIKey of (2-bromo-4,5-difluorophenoxy)boronic acid?
The InChIKey is YNMBTAROLBMPHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BBrF2O3/c8-3-1-4(9)5(10)2-6(3)13-7(11)12/h1-2,11-12H.
What are the key properties of (2-bromo-4,5-difluorophenoxy)boronic acid?
(2-bromo-4,5-difluorophenoxy)boronic acid has a molecular weight of 252.81 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4,5-difluorophenoxy)boronic acid is sourced from PubChem (CID 142781250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).