C32H36N2O2 — CID 142781338
butyl 2-[(2R)-2-methyl-4-[(S)-phenyl-[4-(2-phenylethynyl)phenyl]methyl]piperazin-1-yl]acetate (PubChem CID 142781338) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is butyl 2-[(2R)-2-methyl-4-[(S)-phenyl-[4-(2-phenylethynyl)phenyl]methyl]piperazin-1-yl]acetate.
| Compound Name | butyl 2-[(2R)-2-methyl-4-[(S)-phenyl-[4-(2-phenylethynyl)phenyl]methyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 142781338 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | butyl 2-[(2R)-2-methyl-4-[(S)-phenyl-[4-(2-phenylethynyl)phenyl]methyl]piperazin-1-yl]acetate |
| SMILES | CCCCOC(=O)CN1CCN(C(c2ccccc2)c2ccc(C#Cc3ccccc3)cc2)C[C@H]1C |
| InChI | InChI=1S/C32H36N2O2/c1-3-4-23-36-31(35)25-33-21-22-34(24-26(33)2)32(29-13-9-6-10-14-29)30-19-17-28(18-20-30)16-15-27-11-7-5-8-12-27/h5-14,17-20,26,32H,3-4,21-25H2,1-2H3/t26-,32?/m1/s1 |
| InChIKey | ZDIQFSTWVQCBQK-PSPFREQMSA-N |
| XLogP | 5.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|