About 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole
1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole (PubChem CID 142783454) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole.
Molecular Properties
| Compound Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole |
| PubChem CID | 142783454 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole |
| SMILES | CC1(n2ccnc2)C=CC=CC1 |
| InChI | InChI=1S/C10H12N2/c1-10(5-3-2-4-6-10)12-8-7-11-9-12/h2-5,7-9H,6H2,1H3 |
| InChIKey | BIWZKOFGJGYNFL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole?
The IUPAC name of 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole (CID 142783454) is 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole.
What is the SMILES notation for 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole?
The canonical SMILES for 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole is CC1(n2ccnc2)C=CC=CC1.
What is the InChIKey of 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole?
The InChIKey is BIWZKOFGJGYNFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-10(5-3-2-4-6-10)12-8-7-11-9-12/h2-5,7-9H,6H2,1H3.
What are the key properties of 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole?
1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole has a molecular weight of 160.22 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylcyclohexa-2,4-dien-1-yl)imidazole is sourced from PubChem (CID 142783454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).