C21H29Cl2N3O6S — CID 142783619
tert-butyl 2-[2-[(1,6-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-1-[formyl(hydroxy)amino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 142783619) has the molecular formula C21H29Cl2N3O6S and a molecular weight of 522.45 g/mol. Its IUPAC name is tert-butyl 2-[2-[(1,6-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-1-[formyl(hydroxy)amino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(1,6-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-1-[formyl(hydroxy)amino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142783619 |
| Molecular Formula | C21H29Cl2N3O6S |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | tert-butyl 2-[2-[(1,6-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-1-[formyl(hydroxy)amino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(CS(=O)(=O)N1CCc2cc(Cl)ccc2C1Cl)N(O)C=O |
| InChI | InChI=1S/C21H29Cl2N3O6S/c1-21(2,3)32-20(28)24-9-4-5-17(24)18(25(29)13-27)12-33(30,31)26-10-8-14-11-15(22)6-7-16(14)19(26)23/h6-7,11,13,17-19,29H,4-5,8-10,12H2,1-3H3 |
| InChIKey | FARWMGSYELAYDC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|