C26H39N5O2 — CID 142784078
2,3-bis(4-cyclopropylpiperazin-1-yl)-4-(morpholin-4-ylmethyl)benzaldehyde (PubChem CID 142784078) has the molecular formula C26H39N5O2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 2,3-bis(4-cyclopropylpiperazin-1-yl)-4-(morpholin-4-ylmethyl)benzaldehyde.
| Compound Name | 2,3-bis(4-cyclopropylpiperazin-1-yl)-4-(morpholin-4-ylmethyl)benzaldehyde |
|---|---|
| PubChem CID | 142784078 |
| Molecular Formula | C26H39N5O2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | 2,3-bis(4-cyclopropylpiperazin-1-yl)-4-(morpholin-4-ylmethyl)benzaldehyde |
| SMILES | O=Cc1ccc(CN2CCOCC2)c(N2CCN(C3CC3)CC2)c1N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C26H39N5O2/c32-20-22-2-1-21(19-27-15-17-33-18-16-27)25(30-11-7-28(8-12-30)23-3-4-23)26(22)31-13-9-29(10-14-31)24-5-6-24/h1-2,20,23-24H,3-19H2 |
| InChIKey | IMMZAPLIQOVSQC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 42.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|