C15H21ClN2O3 — CID 142784751
ethyl 3-[(3-carbamoyl-1-chloropentan-3-yl)amino]benzoate (PubChem CID 142784751) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is ethyl 3-[(3-carbamoyl-1-chloropentan-3-yl)amino]benzoate.
| Compound Name | ethyl 3-[(3-carbamoyl-1-chloropentan-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 142784751 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 3-[(3-carbamoyl-1-chloropentan-3-yl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(CC)(CCCl)C(N)=O)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-3-15(8-9-16,14(17)20)18-12-7-5-6-11(10-12)13(19)21-4-2/h5-7,10,18H,3-4,8-9H2,1-2H3,(H2,17,20) |
| InChIKey | ZCANNWMAVYVJBL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|