C7H9F2N3O — CID 142786102
5-(difluoromethyl)-N-ethyl-1H-pyrazole-4-carboxamide (PubChem CID 142786102) has the molecular formula C7H9F2N3O and a molecular weight of 189.16 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-ethyl-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(difluoromethyl)-N-ethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142786102 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 5-(difluoromethyl)-N-ethyl-1H-pyrazole-4-carboxamide |
| SMILES | CCNC(=O)c1cn[nH]c1C(F)F |
| InChI | InChI=1S/C7H9F2N3O/c1-2-10-7(13)4-3-11-12-5(4)6(8)9/h3,6H,2H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | CQEXQGQXPOXAOJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |