C42H64F2N4O5 — CID 142786438
5-fluoro-N-[9-[4-[1-[9-[(5-fluoro-2-hydroxybenzoyl)amino]nonyl]piperidin-4-yl]oxypiperidin-1-yl]nonyl]-2-hydroxybenzamide (PubChem CID 142786438) has the molecular formula C42H64F2N4O5 and a molecular weight of 742.99 g/mol. Its IUPAC name is 5-fluoro-N-[9-[4-[1-[9-[(5-fluoro-2-hydroxybenzoyl)amino]nonyl]piperidin-4-yl]oxypiperidin-1-yl]nonyl]-2-hydroxybenzamide.
| Compound Name | 5-fluoro-N-[9-[4-[1-[9-[(5-fluoro-2-hydroxybenzoyl)amino]nonyl]piperidin-4-yl]oxypiperidin-1-yl]nonyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 142786438 |
| Molecular Formula | C42H64F2N4O5 |
| Molecular Weight | 742.99 g/mol |
| Exact Mass | 742.48 |
| IUPAC Name | 5-fluoro-N-[9-[4-[1-[9-[(5-fluoro-2-hydroxybenzoyl)amino]nonyl]piperidin-4-yl]oxypiperidin-1-yl]nonyl]-2-hydroxybenzamide |
| SMILES | O=C(NCCCCCCCCCN1CCC(OC2CCN(CCCCCCCCCNC(=O)c3cc(F)ccc3O)CC2)CC1)c1cc(F)ccc1O |
| InChI | InChI=1S/C42H64F2N4O5/c43-33-15-17-39(49)37(31-33)41(51)45-23-11-7-3-1-5-9-13-25-47-27-19-35(20-28-47)53-36-21-29-48(30-22-36)26-14-10-6-2-4-8-12-24-46-42(52)38-32-34(44)16-18-40(38)50/h15-18,31-32,35-36,49-50H,1-14,19-30H2,(H,45,51)(H,46,52) |
| InChIKey | LEMOHVDNAJDXQD-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.99 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|