C14H14BrN5 — CID 142789805
6-bromo-2-(quinolin-6-ylmethyl)-1H-pyrazine-2,3-diamine (PubChem CID 142789805) has the molecular formula C14H14BrN5 and a molecular weight of 332.21 g/mol. Its IUPAC name is 6-bromo-2-(quinolin-6-ylmethyl)-1H-pyrazine-2,3-diamine.
| Compound Name | 6-bromo-2-(quinolin-6-ylmethyl)-1H-pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 142789805 |
| Molecular Formula | C14H14BrN5 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 6-bromo-2-(quinolin-6-ylmethyl)-1H-pyrazine-2,3-diamine |
| SMILES | NC1=NC=C(Br)NC1(N)Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C14H14BrN5/c15-12-8-19-13(16)14(17,20-12)7-9-3-4-11-10(6-9)2-1-5-18-11/h1-6,8,20H,7,17H2,(H2,16,19) |
| InChIKey | ZANJNLVJNJTTJP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|