C15H14ClN5O2 — CID 142792758
6-chloro-3-nitro-2-(quinolin-6-ylmethyl)-1H-pyridine-2,4-diamine (PubChem CID 142792758) has the molecular formula C15H14ClN5O2 and a molecular weight of 331.76 g/mol. Its IUPAC name is 6-chloro-3-nitro-2-(quinolin-6-ylmethyl)-1H-pyridine-2,4-diamine.
| Compound Name | 6-chloro-3-nitro-2-(quinolin-6-ylmethyl)-1H-pyridine-2,4-diamine |
|---|---|
| PubChem CID | 142792758 |
| Molecular Formula | C15H14ClN5O2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 6-chloro-3-nitro-2-(quinolin-6-ylmethyl)-1H-pyridine-2,4-diamine |
| SMILES | NC1=C([N+](=O)[O-])C(N)(Cc2ccc3ncccc3c2)NC(Cl)=C1 |
| InChI | InChI=1S/C15H14ClN5O2/c16-13-7-11(17)14(21(22)23)15(18,20-13)8-9-3-4-12-10(6-9)2-1-5-19-12/h1-7,20H,8,17-18H2 |
| InChIKey | BLDQIZNLZGNWRD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|