C12H7Br2N3O6 — CID 142790671
4-bromo-1-(4-bromo-6,6-dinitrocyclohexa-1,3-dien-1-yl)-2-nitrobenzene (PubChem CID 142790671) has the molecular formula C12H7Br2N3O6 and a molecular weight of 449.01 g/mol. Its IUPAC name is 4-bromo-1-(4-bromo-6,6-dinitrocyclohexa-1,3-dien-1-yl)-2-nitrobenzene.
| Compound Name | 4-bromo-1-(4-bromo-6,6-dinitrocyclohexa-1,3-dien-1-yl)-2-nitrobenzene |
|---|---|
| PubChem CID | 142790671 |
| Molecular Formula | C12H7Br2N3O6 |
| Molecular Weight | 449.01 g/mol |
| Exact Mass | 446.87 |
| IUPAC Name | 4-bromo-1-(4-bromo-6,6-dinitrocyclohexa-1,3-dien-1-yl)-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1C1=CC=C(Br)CC1([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C12H7Br2N3O6/c13-7-1-3-9(11(5-7)15(18)19)10-4-2-8(14)6-12(10,16(20)21)17(22)23/h1-5H,6H2 |
| InChIKey | POHACEIGPFIGBF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.01 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|