C29H46N4O — CID 142790741
4-[4-[4-(5,5,8,8-tetraethyl-6,7-dihydronaphthalen-2-yl)triazol-1-yl]piperidin-1-yl]butan-1-ol (PubChem CID 142790741) has the molecular formula C29H46N4O and a molecular weight of 466.71 g/mol. Its IUPAC name is 4-[4-[4-(5,5,8,8-tetraethyl-6,7-dihydronaphthalen-2-yl)triazol-1-yl]piperidin-1-yl]butan-1-ol.
| Compound Name | 4-[4-[4-(5,5,8,8-tetraethyl-6,7-dihydronaphthalen-2-yl)triazol-1-yl]piperidin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 142790741 |
| Molecular Formula | C29H46N4O |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | 4-[4-[4-(5,5,8,8-tetraethyl-6,7-dihydronaphthalen-2-yl)triazol-1-yl]piperidin-1-yl]butan-1-ol |
| SMILES | CCC1(CC)CCC(CC)(CC)c2cc(-c3cn(C4CCN(CCCCO)CC4)nn3)ccc21 |
| InChI | InChI=1S/C29H46N4O/c1-5-28(6-2)15-16-29(7-3,8-4)26-21-23(11-12-25(26)28)27-22-33(31-30-27)24-13-18-32(19-14-24)17-9-10-20-34/h11-12,21-22,24,34H,5-10,13-20H2,1-4H3 |
| InChIKey | RFRVNWOEGMQSTR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|