C13H16N4O4 — CID 142791226
1-[2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenoxy]butan-2-ol (PubChem CID 142791226) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-[2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenoxy]butan-2-ol.
| Compound Name | 1-[2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenoxy]butan-2-ol |
|---|---|
| PubChem CID | 142791226 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenoxy]butan-2-ol |
| SMILES | CCC(O)COc1cc([N+](=O)[O-])ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C13H16N4O4/c1-3-11(18)7-21-13-6-10(17(19)20)4-5-12(13)16-8-14-9(2)15-16/h4-6,8,11,18H,3,7H2,1-2H3 |
| InChIKey | ZZKPPKPFCLRBMK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|