C14H20N6O3 — CID 161181049
1-N-[2-[2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenoxy]ethyl]propane-1,2-diamine (PubChem CID 161181049) has the molecular formula C14H20N6O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-N-[2-[2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenoxy]ethyl]propane-1,2-diamine.
| Compound Name | 1-N-[2-[2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenoxy]ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 161181049 |
| Molecular Formula | C14H20N6O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-N-[2-[2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenoxy]ethyl]propane-1,2-diamine |
| SMILES | Cc1ncn(-c2ccc([N+](=O)[O-])cc2OCCNCC(C)N)n1 |
| InChI | InChI=1S/C14H20N6O3/c1-10(15)8-16-5-6-23-14-7-12(20(21)22)3-4-13(14)19-9-17-11(2)18-19/h3-4,7,9-10,16H,5-6,8,15H2,1-2H3 |
| InChIKey | USLONALJHAGSLT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|