C12H10BrFN2 — CID 142791344
1-[(4-bromo-2-fluorophenyl)methyl]-1,4-diazepine (PubChem CID 142791344) has the molecular formula C12H10BrFN2 and a molecular weight of 281.13 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-1,4-diazepine.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-1,4-diazepine |
|---|---|
| PubChem CID | 142791344 |
| Molecular Formula | C12H10BrFN2 |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-1,4-diazepine |
| SMILES | Fc1cc(Br)ccc1CN1C=CC=NC=C1 |
| InChI | InChI=1S/C12H10BrFN2/c13-11-3-2-10(12(14)8-11)9-16-6-1-4-15-5-7-16/h1-8H,9H2 |
| InChIKey | CPQPLMMENDMQQC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |