C18H14BFN4O3 — CID 142791607
[2-(2-fluorophenyl)-6-(1-methylpyrazol-4-yl)-1,8-naphthyridin-4-yl]oxyboronic acid (PubChem CID 142791607) has the molecular formula C18H14BFN4O3 and a molecular weight of 364.15 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-6-(1-methylpyrazol-4-yl)-1,8-naphthyridin-4-yl]oxyboronic acid.
| Compound Name | [2-(2-fluorophenyl)-6-(1-methylpyrazol-4-yl)-1,8-naphthyridin-4-yl]oxyboronic acid |
|---|---|
| PubChem CID | 142791607 |
| Molecular Formula | C18H14BFN4O3 |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-(2-fluorophenyl)-6-(1-methylpyrazol-4-yl)-1,8-naphthyridin-4-yl]oxyboronic acid |
| SMILES | Cn1cc(-c2cnc3nc(-c4ccccc4F)cc(OB(O)O)c3c2)cn1 |
| InChI | InChI=1S/C18H14BFN4O3/c1-24-10-12(9-22-24)11-6-14-17(27-19(25)26)7-16(23-18(14)21-8-11)13-4-2-3-5-15(13)20/h2-10,25-26H,1H3 |
| InChIKey | ZXBMRWQNOOLLGT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|