C18H10N2O — CID 142793758
2-(6-hydroxynaphthalen-2-yl)benzene-1,3-dicarbonitrile (PubChem CID 142793758) has the molecular formula C18H10N2O and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(6-hydroxynaphthalen-2-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-(6-hydroxynaphthalen-2-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 142793758 |
| Molecular Formula | C18H10N2O |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-(6-hydroxynaphthalen-2-yl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1-c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C18H10N2O/c19-10-15-2-1-3-16(11-20)18(15)14-5-4-13-9-17(21)7-6-12(13)8-14/h1-9,21H |
| InChIKey | KIGMDVLUOQKYIX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |