C18H22F3N5O3 — CID 142794285
3-[1-(5-amino-1,2,4-oxadiazol-3-yl)-2,2-dimethylpropyl]-5-cyclopropyl-4-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide (PubChem CID 142794285) has the molecular formula C18H22F3N5O3 and a molecular weight of 413.40 g/mol. Its IUPAC name is 3-[1-(5-amino-1,2,4-oxadiazol-3-yl)-2,2-dimethylpropyl]-5-cyclopropyl-4-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide.
| Compound Name | 3-[1-(5-amino-1,2,4-oxadiazol-3-yl)-2,2-dimethylpropyl]-5-cyclopropyl-4-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142794285 |
| Molecular Formula | C18H22F3N5O3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-[1-(5-amino-1,2,4-oxadiazol-3-yl)-2,2-dimethylpropyl]-5-cyclopropyl-4-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
| SMILES | CC(C)(C)C(c1noc(N)n1)c1c(C(N)=O)ncc(C2CC2)c1OCC(F)(F)F |
| InChI | InChI=1S/C18H22F3N5O3/c1-17(2,3)11(15-25-16(23)29-26-15)10-12(14(22)27)24-6-9(8-4-5-8)13(10)28-7-18(19,20)21/h6,8,11H,4-5,7H2,1-3H3,(H2,22,27)(H2,23,25,26) |
| InChIKey | HJXXIOFBJPOCEJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |