C26H25FN4O5S — CID 142797068
3-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-4-methoxy-2-(oxan-4-ylamino)benzamide (PubChem CID 142797068) has the molecular formula C26H25FN4O5S and a molecular weight of 524.57 g/mol. Its IUPAC name is 3-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-4-methoxy-2-(oxan-4-ylamino)benzamide.
| Compound Name | 3-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-4-methoxy-2-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 142797068 |
| Molecular Formula | C26H25FN4O5S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 3-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-4-methoxy-2-(oxan-4-ylamino)benzamide |
| SMILES | COc1ccc(C(N)=O)c(NC2CCOCC2)c1-c1n[nH]c2ccc(S(=O)(=O)c3cccc(F)c3)cc12 |
| InChI | InChI=1S/C26H25FN4O5S/c1-35-22-8-6-19(26(28)32)24(29-16-9-11-36-12-10-16)23(22)25-20-14-18(5-7-21(20)30-31-25)37(33,34)17-4-2-3-15(27)13-17/h2-8,13-14,16,29H,9-12H2,1H3,(H2,28,32)(H,30,31) |
| InChIKey | QUJNSDBFRGQNSG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |