C26H24F2N4O2 — CID 142797108
2-fluoro-3-[5-[(3-fluorophenyl)methyl]-1H-indazol-3-yl]-5-(oxan-4-ylamino)benzamide (PubChem CID 142797108) has the molecular formula C26H24F2N4O2 and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-fluoro-3-[5-[(3-fluorophenyl)methyl]-1H-indazol-3-yl]-5-(oxan-4-ylamino)benzamide.
| Compound Name | 2-fluoro-3-[5-[(3-fluorophenyl)methyl]-1H-indazol-3-yl]-5-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 142797108 |
| Molecular Formula | C26H24F2N4O2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-fluoro-3-[5-[(3-fluorophenyl)methyl]-1H-indazol-3-yl]-5-(oxan-4-ylamino)benzamide |
| SMILES | NC(=O)c1cc(NC2CCOCC2)cc(-c2n[nH]c3ccc(Cc4cccc(F)c4)cc23)c1F |
| InChI | InChI=1S/C26H24F2N4O2/c27-17-3-1-2-15(11-17)10-16-4-5-23-20(12-16)25(32-31-23)21-13-19(14-22(24(21)28)26(29)33)30-18-6-8-34-9-7-18/h1-5,11-14,18,30H,6-10H2,(H2,29,33)(H,31,32) |
| InChIKey | ZWGNHMWZLQEXOE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |